About 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol
1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol (PubChem CID 114714975) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol.
Molecular Properties
| Compound Name | 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol |
| PubChem CID | 114714975 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol |
| SMILES | CCCN1CCCC2(CC1)CC(O)c1ccccc1O2 |
| InChI | InChI=1S/C17H25NO2/c1-2-10-18-11-5-8-17(9-12-18)13-15(19)14-6-3-4-7-16(14)20-17/h3-4,6-7,15,19H,2,5,8-13H2,1H3 |
| InChIKey | LYWPROHNEOZMNR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol?
The IUPAC name of 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol (CID 114714975) is 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol.
What is the SMILES notation for 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol?
The canonical SMILES for 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol is CCCN1CCCC2(CC1)CC(O)c1ccccc1O2.
What is the InChIKey of 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol?
The InChIKey is LYWPROHNEOZMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-2-10-18-11-5-8-17(9-12-18)13-15(19)14-6-3-4-7-16(14)20-17/h3-4,6-7,15,19H,2,5,8-13H2,1H3.
What are the key properties of 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol?
1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol has a molecular weight of 275.39 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol is sourced from PubChem (CID 114714975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).