C16H24O4 — CID 11471507
(7E,9S,11R,12Z)-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-7,12-diene-2,10-dione (PubChem CID 11471507) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (7E,9S,11R,12Z)-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-7,12-diene-2,10-dione.
| Compound Name | (7E,9S,11R,12Z)-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-7,12-diene-2,10-dione |
|---|---|
| PubChem CID | 11471507 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (7E,9S,11R,12Z)-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-7,12-diene-2,10-dione |
| SMILES | CO[C@H]1/C=C/CCCCC(=O)OC/C(C)=C\[C@@H](C)C1=O |
| InChI | InChI=1S/C16H24O4/c1-12-10-13(2)16(18)14(19-3)8-6-4-5-7-9-15(17)20-11-12/h6,8,10,13-14H,4-5,7,9,11H2,1-3H3/b8-6+,12-10-/t13-,14+/m1/s1 |
| InChIKey | GJBNDYQBDJDVGD-BHNMGGFESA-N |
| XLogP | 2.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|