C17H17BrO3 — CID 114715418
2-(2-bromo-4-methylphenyl)-6-methoxy-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114715418) has the molecular formula C17H17BrO3 and a molecular weight of 349.22 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenyl)-6-methoxy-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-(2-bromo-4-methylphenyl)-6-methoxy-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114715418 |
| Molecular Formula | C17H17BrO3 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-(2-bromo-4-methylphenyl)-6-methoxy-3,4-dihydro-2H-chromen-4-ol |
| SMILES | COc1ccc2c(c1)C(O)CC(c1ccc(C)cc1Br)O2 |
| InChI | InChI=1S/C17H17BrO3/c1-10-3-5-12(14(18)7-10)17-9-15(19)13-8-11(20-2)4-6-16(13)21-17/h3-8,15,17,19H,9H2,1-2H3 |
| InChIKey | FGMDTNJWQVQGBO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |