About 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole
7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole (PubChem CID 114716150) has the molecular formula C17H14BrN3
and a molecular weight of 340.22 g/mol. Its IUPAC name is 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole |
| PubChem CID | 114716150 |
| Molecular Formula | C17H14BrN3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole |
| SMILES | Brc1cccc(-n2cncc2-c2cccc3c2NCC3)c1 |
| InChI | InChI=1S/C17H14BrN3/c18-13-4-2-5-14(9-13)21-11-19-10-16(21)15-6-1-3-12-7-8-20-17(12)15/h1-6,9-11,20H,7-8H2 |
| InChIKey | RNYPHKHPILAWQO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole?
The IUPAC name of 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole (CID 114716150) is 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole.
What is the SMILES notation for 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole?
The canonical SMILES for 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole is Brc1cccc(-n2cncc2-c2cccc3c2NCC3)c1.
What is the InChIKey of 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole?
The InChIKey is RNYPHKHPILAWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrN3/c18-13-4-2-5-14(9-13)21-11-19-10-16(21)15-6-1-3-12-7-8-20-17(12)15/h1-6,9-11,20H,7-8H2.
What are the key properties of 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole?
7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole has a molecular weight of 340.22 g/mol, XLogP of 4.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(3-bromophenyl)imidazol-4-yl]-2,3-dihydro-1H-indole is sourced from PubChem (CID 114716150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).