C16H28O4 — CID 11471637
tert-butyl 2-[(4R,6R)-2,2-dimethyl-6-(2-methylprop-2-enyl)-1,3-dioxan-4-yl]acetate (PubChem CID 11471637) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is tert-butyl 2-[(4R,6R)-2,2-dimethyl-6-(2-methylprop-2-enyl)-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,6R)-2,2-dimethyl-6-(2-methylprop-2-enyl)-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 11471637 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | tert-butyl 2-[(4R,6R)-2,2-dimethyl-6-(2-methylprop-2-enyl)-1,3-dioxan-4-yl]acetate |
| SMILES | C=C(C)C[C@@H]1C[C@H](CC(=O)OC(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C16H28O4/c1-11(2)8-12-9-13(19-16(6,7)18-12)10-14(17)20-15(3,4)5/h12-13H,1,8-10H2,2-7H3/t12-,13-/m1/s1 |
| InChIKey | KLICMOOMEPZLDA-CHWSQXEVSA-N |
| XLogP | 3.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|