C14H9F3N4 — CID 114716552
3-[3-(2,3,4-trifluorophenyl)imidazol-4-yl]pyridin-4-amine (PubChem CID 114716552) has the molecular formula C14H9F3N4 and a molecular weight of 290.25 g/mol. Its IUPAC name is 3-[3-(2,3,4-trifluorophenyl)imidazol-4-yl]pyridin-4-amine.
| Compound Name | 3-[3-(2,3,4-trifluorophenyl)imidazol-4-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 114716552 |
| Molecular Formula | C14H9F3N4 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3-[3-(2,3,4-trifluorophenyl)imidazol-4-yl]pyridin-4-amine |
| SMILES | Nc1ccncc1-c1cncn1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H9F3N4/c15-9-1-2-11(14(17)13(9)16)21-7-20-6-12(21)8-5-19-4-3-10(8)18/h1-7H,(H2,18,19) |
| InChIKey | SMKGSZIOPXFALC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|