C16H15ClN4 — CID 114718909
3-[3-[2-(4-chlorophenyl)ethyl]imidazol-4-yl]pyridin-4-amine (PubChem CID 114718909) has the molecular formula C16H15ClN4 and a molecular weight of 298.78 g/mol. Its IUPAC name is 3-[3-[2-(4-chlorophenyl)ethyl]imidazol-4-yl]pyridin-4-amine.
| Compound Name | 3-[3-[2-(4-chlorophenyl)ethyl]imidazol-4-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 114718909 |
| Molecular Formula | C16H15ClN4 |
| Molecular Weight | 298.78 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-[3-[2-(4-chlorophenyl)ethyl]imidazol-4-yl]pyridin-4-amine |
| SMILES | Nc1ccncc1-c1cncn1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN4/c17-13-3-1-12(2-4-13)6-8-21-11-20-10-16(21)14-9-19-7-5-15(14)18/h1-5,7,9-11H,6,8H2,(H2,18,19) |
| InChIKey | ZLCTVPGSLAJFFV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.78 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |