C15H23N5 — CID 114718996
5-[3-[1-(diethylamino)propan-2-yl]imidazol-4-yl]pyridin-2-amine (PubChem CID 114718996) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is 5-[3-[1-(diethylamino)propan-2-yl]imidazol-4-yl]pyridin-2-amine.
| Compound Name | 5-[3-[1-(diethylamino)propan-2-yl]imidazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 114718996 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 5-[3-[1-(diethylamino)propan-2-yl]imidazol-4-yl]pyridin-2-amine |
| SMILES | CCN(CC)CC(C)n1cncc1-c1ccc(N)nc1 |
| InChI | InChI=1S/C15H23N5/c1-4-19(5-2)10-12(3)20-11-17-9-14(20)13-6-7-15(16)18-8-13/h6-9,11-12H,4-5,10H2,1-3H3,(H2,16,18) |
| InChIKey | RNVDCMUQLIVMKF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |