C14H14F3N3O — CID 114720059
oxolan-3-yl-[3-(2,3,5-trifluorophenyl)imidazol-4-yl]methanamine (PubChem CID 114720059) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is oxolan-3-yl-[3-(2,3,5-trifluorophenyl)imidazol-4-yl]methanamine.
| Compound Name | oxolan-3-yl-[3-(2,3,5-trifluorophenyl)imidazol-4-yl]methanamine |
|---|---|
| PubChem CID | 114720059 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | oxolan-3-yl-[3-(2,3,5-trifluorophenyl)imidazol-4-yl]methanamine |
| SMILES | NC(c1cncn1-c1cc(F)cc(F)c1F)C1CCOC1 |
| InChI | InChI=1S/C14H14F3N3O/c15-9-3-10(16)13(17)11(4-9)20-7-19-5-12(20)14(18)8-1-2-21-6-8/h3-5,7-8,14H,1-2,6,18H2 |
| InChIKey | CTXHLONEKPGDGK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|