C10H19O2PS3 — CID 11472056
(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl) 2,2-dimethylpropanedithioate (PubChem CID 11472056) has the molecular formula C10H19O2PS3 and a molecular weight of 298.44 g/mol. Its IUPAC name is (5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl) 2,2-dimethylpropanedithioate.
| Compound Name | (5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl) 2,2-dimethylpropanedithioate |
|---|---|
| PubChem CID | 11472056 |
| Molecular Formula | C10H19O2PS3 |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl) 2,2-dimethylpropanedithioate |
| SMILES | CC1(C)COP(=S)(SC(=S)C(C)(C)C)OC1 |
| InChI | InChI=1S/C10H19O2PS3/c1-9(2,3)8(14)16-13(15)11-6-10(4,5)7-12-13/h6-7H2,1-5H3 |
| InChIKey | PQYYHMRWCHLIIQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|