About 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole
7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole (PubChem CID 114721013) has the molecular formula C16H21N3O
and a molecular weight of 271.36 g/mol. Its IUPAC name is 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole |
| PubChem CID | 114721013 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole |
| SMILES | COCCC(C)n1cncc1-c1cccc2c1NCC2 |
| InChI | InChI=1S/C16H21N3O/c1-12(7-9-20-2)19-11-17-10-15(19)14-5-3-4-13-6-8-18-16(13)14/h3-5,10-12,18H,6-9H2,1-2H3 |
| InChIKey | XPZKRMSCIFFAOW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole?
The IUPAC name of 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole (CID 114721013) is 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole.
What is the SMILES notation for 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole?
The canonical SMILES for 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole is COCCC(C)n1cncc1-c1cccc2c1NCC2.
What is the InChIKey of 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole?
The InChIKey is XPZKRMSCIFFAOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O/c1-12(7-9-20-2)19-11-17-10-15(19)14-5-3-4-13-6-8-18-16(13)14/h3-5,10-12,18H,6-9H2,1-2H3.
What are the key properties of 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole?
7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole has a molecular weight of 271.36 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(4-methoxybutan-2-yl)imidazol-4-yl]-2,3-dihydro-1H-indole is sourced from PubChem (CID 114721013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).