About 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide
2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide (PubChem CID 11472129) has the molecular formula C15H13BrN2
and a molecular weight of 301.19 g/mol. Its IUPAC name is 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide.
Molecular Properties
| Compound Name | 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide |
| PubChem CID | 11472129 |
| Molecular Formula | C15H13BrN2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide |
| SMILES | Br.c1ccc2c(c1)C1=NCCN1c1ccccc1-2 |
| InChI | InChI=1S/C15H12N2.BrH/c1-2-7-13-11(5-1)12-6-3-4-8-14(12)17-10-9-16-15(13)17;/h1-8H,9-10H2;1H |
| InChIKey | VMNZZRBTVDTAMT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide?
The IUPAC name of 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide (CID 11472129) is 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide.
What is the SMILES notation for 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide?
The canonical SMILES for 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide is Br.c1ccc2c(c1)C1=NCCN1c1ccccc1-2.
What is the InChIKey of 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide?
The InChIKey is VMNZZRBTVDTAMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2.BrH/c1-2-7-13-11(5-1)12-6-3-4-8-14(12)17-10-9-16-15(13)17;/h1-8H,9-10H2;1H.
What are the key properties of 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide?
2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide has a molecular weight of 301.19 g/mol, XLogP of 3.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroimidazo[1,2-f]phenanthridine;hydrobromide is sourced from PubChem (CID 11472129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).