C11H17F2N3 — CID 114721475
2-[3-(2,2-difluoroethyl)imidazol-4-yl]-6-methylpiperidine (PubChem CID 114721475) has the molecular formula C11H17F2N3 and a molecular weight of 229.27 g/mol. Its IUPAC name is 2-[3-(2,2-difluoroethyl)imidazol-4-yl]-6-methylpiperidine.
| Compound Name | 2-[3-(2,2-difluoroethyl)imidazol-4-yl]-6-methylpiperidine |
|---|---|
| PubChem CID | 114721475 |
| Molecular Formula | C11H17F2N3 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 2-[3-(2,2-difluoroethyl)imidazol-4-yl]-6-methylpiperidine |
| SMILES | CC1CCCC(c2cncn2CC(F)F)N1 |
| InChI | InChI=1S/C11H17F2N3/c1-8-3-2-4-9(15-8)10-5-14-7-16(10)6-11(12)13/h5,7-9,11,15H,2-4,6H2,1H3 |
| InChIKey | HPCFAXMBBPQDKF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |