About 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine
2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine (PubChem CID 114722738) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine |
| PubChem CID | 114722738 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine |
| SMILES | CC1CN(C)CCC1n1cncc1CCN |
| InChI | InChI=1S/C12H22N4/c1-10-8-15(2)6-4-12(10)16-9-14-7-11(16)3-5-13/h7,9-10,12H,3-6,8,13H2,1-2H3 |
| InChIKey | NGOIKIGSZOMINJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine?
The IUPAC name of 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine (CID 114722738) is 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine.
What is the SMILES notation for 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine?
The canonical SMILES for 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine is CC1CN(C)CCC1n1cncc1CCN.
What is the InChIKey of 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine?
The InChIKey is NGOIKIGSZOMINJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4/c1-10-8-15(2)6-4-12(10)16-9-14-7-11(16)3-5-13/h7,9-10,12H,3-6,8,13H2,1-2H3.
What are the key properties of 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine?
2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine has a molecular weight of 222.34 g/mol, XLogP of 0.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1,3-dimethylpiperidin-4-yl)imidazol-4-yl]ethanamine is sourced from PubChem (CID 114722738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).