C20H34O2 — CID 11472281
(1S,2S,5S,7S,10S,11S)-2,7,10-trimethyl-10-(4-methylpent-3-enyl)-6-oxatricyclo[9.1.0.05,7]dodecan-2-ol (PubChem CID 11472281) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1S,2S,5S,7S,10S,11S)-2,7,10-trimethyl-10-(4-methylpent-3-enyl)-6-oxatricyclo[9.1.0.05,7]dodecan-2-ol.
| Compound Name | (1S,2S,5S,7S,10S,11S)-2,7,10-trimethyl-10-(4-methylpent-3-enyl)-6-oxatricyclo[9.1.0.05,7]dodecan-2-ol |
|---|---|
| PubChem CID | 11472281 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1S,2S,5S,7S,10S,11S)-2,7,10-trimethyl-10-(4-methylpent-3-enyl)-6-oxatricyclo[9.1.0.05,7]dodecan-2-ol |
| SMILES | CC(C)=CCC[C@@]1(C)CC[C@]2(C)O[C@H]2CC[C@](C)(O)[C@H]2C[C@@H]21 |
| InChI | InChI=1S/C20H34O2/c1-14(2)7-6-9-18(3)11-12-20(5)17(22-20)8-10-19(4,21)16-13-15(16)18/h7,15-17,21H,6,8-13H2,1-5H3/t15-,16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | TVFOQOGYYBMWNB-RABCQHRBSA-N |
| XLogP | 4.86 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|