C18H30O2Si — CID 11472284
(1R,2S,4R,6R,7S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyltricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 11472284) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is (1R,2S,4R,6R,7S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyltricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2S,4R,6R,7S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyltricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 11472284 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (1R,2S,4R,6R,7S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyltricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]1(C)C[C@H]2[C@@H](C1=O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C18H30O2Si/c1-17(2,3)21(5,6)20-11-18(4)10-14-12-7-8-13(9-12)15(14)16(18)19/h7-8,12-15H,9-11H2,1-6H3/t12-,13+,14-,15+,18-/m1/s1 |
| InChIKey | RKXMJXORQPHVKD-FQRJBHLQSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|