About 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol
2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol (PubChem CID 114722942) has the molecular formula C17H13ClO2
and a molecular weight of 284.74 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol.
Molecular Properties
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol |
| PubChem CID | 114722942 |
| Molecular Formula | C17H13ClO2 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol |
| SMILES | OC1(c2cc3cc(Cl)ccc3o2)Cc2ccccc2C1 |
| InChI | InChI=1S/C17H13ClO2/c18-14-5-6-15-13(7-14)8-16(20-15)17(19)9-11-3-1-2-4-12(11)10-17/h1-8,19H,9-10H2 |
| InChIKey | KCDXQRXODJGDLN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol?
The IUPAC name of 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol (CID 114722942) is 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol.
What is the SMILES notation for 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol?
The canonical SMILES for 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol is OC1(c2cc3cc(Cl)ccc3o2)Cc2ccccc2C1.
What is the InChIKey of 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol?
The InChIKey is KCDXQRXODJGDLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClO2/c18-14-5-6-15-13(7-14)8-16(20-15)17(19)9-11-3-1-2-4-12(11)10-17/h1-8,19H,9-10H2.
What are the key properties of 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol?
2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol has a molecular weight of 284.74 g/mol, XLogP of 4.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-1-benzofuran-2-yl)-1,3-dihydroinden-2-ol is sourced from PubChem (CID 114722942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).