C13H15ClO4 — CID 114724129
2-(7-chloro-1-benzofuran-2-yl)-1,1-dimethoxypropan-2-ol (PubChem CID 114724129) has the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. Its IUPAC name is 2-(7-chloro-1-benzofuran-2-yl)-1,1-dimethoxypropan-2-ol.
| Compound Name | 2-(7-chloro-1-benzofuran-2-yl)-1,1-dimethoxypropan-2-ol |
|---|---|
| PubChem CID | 114724129 |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-(7-chloro-1-benzofuran-2-yl)-1,1-dimethoxypropan-2-ol |
| SMILES | COC(OC)C(C)(O)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C13H15ClO4/c1-13(15,12(16-2)17-3)10-7-8-5-4-6-9(14)11(8)18-10/h4-7,12,15H,1-3H3 |
| InChIKey | SCBVHRGNNLAQTP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|