C14H16O3 — CID 114724321
1-(1-benzofuran-2-yl)-1-cyclopropyl-2-methoxyethanol (PubChem CID 114724321) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-1-cyclopropyl-2-methoxyethanol.
| Compound Name | 1-(1-benzofuran-2-yl)-1-cyclopropyl-2-methoxyethanol |
|---|---|
| PubChem CID | 114724321 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-1-cyclopropyl-2-methoxyethanol |
| SMILES | COCC(O)(c1cc2ccccc2o1)C1CC1 |
| InChI | InChI=1S/C14H16O3/c1-16-9-14(15,11-6-7-11)13-8-10-4-2-3-5-12(10)17-13/h2-5,8,11,15H,6-7,9H2,1H3 |
| InChIKey | JHXUJLHVXLAPOQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |