C15H20FNO — CID 114728123
1-(7-fluoro-1-benzofuran-2-yl)-N,4-dimethylpentan-1-amine (PubChem CID 114728123) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is 1-(7-fluoro-1-benzofuran-2-yl)-N,4-dimethylpentan-1-amine.
| Compound Name | 1-(7-fluoro-1-benzofuran-2-yl)-N,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 114728123 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(7-fluoro-1-benzofuran-2-yl)-N,4-dimethylpentan-1-amine |
| SMILES | CNC(CCC(C)C)c1cc2cccc(F)c2o1 |
| InChI | InChI=1S/C15H20FNO/c1-10(2)7-8-13(17-3)14-9-11-5-4-6-12(16)15(11)18-14/h4-6,9-10,13,17H,7-8H2,1-3H3 |
| InChIKey | VDIRGQFVJXMBAT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |