C12H9F6N3O — CID 11472813
Gsk232420A (PubChem CID 11472813) has the molecular formula C12H9F6N3O and a molecular weight of 325.21 g/mol. Its IUPAC name is 2-[4-cyano-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)anilino]acetamide.
| Compound Name | Gsk232420A |
|---|---|
| PubChem CID | 11472813 |
| Molecular Formula | C12H9F6N3O |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-[4-cyano-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)anilino]acetamide |
| SMILES | C1=CC(=C(C=C1N(CC(=O)N)CC(F)(F)F)C(F)(F)F)C#N |
| InChI | InChI=1S/C12H9F6N3O/c13-11(14,15)6-21(5-10(20)22)8-2-1-7(4-19)9(3-8)12(16,17)18/h1-3H,5-6H2,(H2,20,22) |
| InChIKey | ZDYGKWOTFUOWOA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | 452 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |