C14H16ClNO2 — CID 114729092
1-(5-chloro-1-benzofuran-2-yl)-N-methyl-1-(oxolan-2-yl)methanamine (PubChem CID 114729092) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is 1-(5-chloro-1-benzofuran-2-yl)-N-methyl-1-(oxolan-2-yl)methanamine.
| Compound Name | 1-(5-chloro-1-benzofuran-2-yl)-N-methyl-1-(oxolan-2-yl)methanamine |
|---|---|
| PubChem CID | 114729092 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-(5-chloro-1-benzofuran-2-yl)-N-methyl-1-(oxolan-2-yl)methanamine |
| SMILES | CNC(c1cc2cc(Cl)ccc2o1)C1CCCO1 |
| InChI | InChI=1S/C14H16ClNO2/c1-16-14(12-3-2-6-17-12)13-8-9-7-10(15)4-5-11(9)18-13/h4-5,7-8,12,14,16H,2-3,6H2,1H3 |
| InChIKey | XUBNZGTXCWKUBK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |