C21H31NS — CID 11472960
(1S,3aR,4S,5aS,10aS,10bS,10cS)-10a-isothiocyanato-1,4,7,7-tetramethyl-1,2,3,3a,4,5,5a,6,8,10,10b,10c-dodecahydropyrene (PubChem CID 11472960) has the molecular formula C21H31NS and a molecular weight of 329.55 g/mol. Its IUPAC name is (1S,3aR,4S,5aS,10aS,10bS,10cS)-10a-isothiocyanato-1,4,7,7-tetramethyl-1,2,3,3a,4,5,5a,6,8,10,10b,10c-dodecahydropyrene.
| Compound Name | (1S,3aR,4S,5aS,10aS,10bS,10cS)-10a-isothiocyanato-1,4,7,7-tetramethyl-1,2,3,3a,4,5,5a,6,8,10,10b,10c-dodecahydropyrene |
|---|---|
| PubChem CID | 11472960 |
| Molecular Formula | C21H31NS |
| Molecular Weight | 329.55 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (1S,3aR,4S,5aS,10aS,10bS,10cS)-10a-isothiocyanato-1,4,7,7-tetramethyl-1,2,3,3a,4,5,5a,6,8,10,10b,10c-dodecahydropyrene |
| SMILES | C[C@H]1C[C@H]2CC(C)(C)CC3=CC[C@@]4(N=C=S)[C@@H]([C@@H]1CC[C@@H]4C)[C@@H]32 |
| InChI | InChI=1S/C21H31NS/c1-13-9-16-11-20(3,4)10-15-7-8-21(22-12-23)14(2)5-6-17(13)19(21)18(15)16/h7,13-14,16-19H,5-6,8-11H2,1-4H3/t13-,14-,16-,17+,18-,19-,21-/m0/s1 |
| InChIKey | UALOZVMNQKNIOV-OXPIXLAOSA-N |
| XLogP | 5.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|