C17H15F2NO — CID 114730411
1-(5-fluoro-1-benzofuran-2-yl)-1-(3-fluoro-5-methylphenyl)-N-methylmethanamine (PubChem CID 114730411) has the molecular formula C17H15F2NO and a molecular weight of 287.31 g/mol. Its IUPAC name is 1-(5-fluoro-1-benzofuran-2-yl)-1-(3-fluoro-5-methylphenyl)-N-methylmethanamine.
| Compound Name | 1-(5-fluoro-1-benzofuran-2-yl)-1-(3-fluoro-5-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114730411 |
| Molecular Formula | C17H15F2NO |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-(5-fluoro-1-benzofuran-2-yl)-1-(3-fluoro-5-methylphenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc(C)cc(F)c1)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C17H15F2NO/c1-10-5-12(8-14(19)6-10)17(20-2)16-9-11-7-13(18)3-4-15(11)21-16/h3-9,17,20H,1-2H3 |
| InChIKey | DWCSGMPNDHUFTR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |