C17H22FNO2 — CID 114730943
N-[(5-fluoro-1-benzofuran-2-yl)-(1-methoxycyclopentyl)methyl]ethanamine (PubChem CID 114730943) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is N-[(5-fluoro-1-benzofuran-2-yl)-(1-methoxycyclopentyl)methyl]ethanamine.
| Compound Name | N-[(5-fluoro-1-benzofuran-2-yl)-(1-methoxycyclopentyl)methyl]ethanamine |
|---|---|
| PubChem CID | 114730943 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[(5-fluoro-1-benzofuran-2-yl)-(1-methoxycyclopentyl)methyl]ethanamine |
| SMILES | CCNC(c1cc2cc(F)ccc2o1)C1(OC)CCCC1 |
| InChI | InChI=1S/C17H22FNO2/c1-3-19-16(17(20-2)8-4-5-9-17)15-11-12-10-13(18)6-7-14(12)21-15/h6-7,10-11,16,19H,3-5,8-9H2,1-2H3 |
| InChIKey | MTLQACCZVNHXJB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |