C17H24FNO2 — CID 114731371
2-ethoxy-2-ethyl-1-(5-fluoro-1-benzofuran-2-yl)-N-methylbutan-1-amine (PubChem CID 114731371) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-ethoxy-2-ethyl-1-(5-fluoro-1-benzofuran-2-yl)-N-methylbutan-1-amine.
| Compound Name | 2-ethoxy-2-ethyl-1-(5-fluoro-1-benzofuran-2-yl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 114731371 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 2-ethoxy-2-ethyl-1-(5-fluoro-1-benzofuran-2-yl)-N-methylbutan-1-amine |
| SMILES | CCOC(CC)(CC)C(NC)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C17H24FNO2/c1-5-17(6-2,20-7-3)16(19-4)15-11-12-10-13(18)8-9-14(12)21-15/h8-11,16,19H,5-7H2,1-4H3 |
| InChIKey | KWYMXFJVRATQKQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |