C16H21NO3 — CID 114731435
(4-methoxyoxan-4-yl)-(5-methyl-1-benzofuran-2-yl)methanamine (PubChem CID 114731435) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (4-methoxyoxan-4-yl)-(5-methyl-1-benzofuran-2-yl)methanamine.
| Compound Name | (4-methoxyoxan-4-yl)-(5-methyl-1-benzofuran-2-yl)methanamine |
|---|---|
| PubChem CID | 114731435 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (4-methoxyoxan-4-yl)-(5-methyl-1-benzofuran-2-yl)methanamine |
| SMILES | COC1(C(N)c2cc3cc(C)ccc3o2)CCOCC1 |
| InChI | InChI=1S/C16H21NO3/c1-11-3-4-13-12(9-11)10-14(20-13)15(17)16(18-2)5-7-19-8-6-16/h3-4,9-10,15H,5-8,17H2,1-2H3 |
| InChIKey | RSROABKTZOVPJA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |