C16H12FNO — CID 114731967
4-(7-fluoro-1-benzofuran-2-yl)-2,3-dihydro-1H-indole (PubChem CID 114731967) has the molecular formula C16H12FNO and a molecular weight of 253.28 g/mol. Its IUPAC name is 4-(7-fluoro-1-benzofuran-2-yl)-2,3-dihydro-1H-indole.
| Compound Name | 4-(7-fluoro-1-benzofuran-2-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 114731967 |
| Molecular Formula | C16H12FNO |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-(7-fluoro-1-benzofuran-2-yl)-2,3-dihydro-1H-indole |
| SMILES | Fc1cccc2cc(-c3cccc4c3CCN4)oc12 |
| InChI | InChI=1S/C16H12FNO/c17-13-5-1-3-10-9-15(19-16(10)13)12-4-2-6-14-11(12)7-8-18-14/h1-6,9,18H,7-8H2 |
| InChIKey | LWWPRBLQKDMSNV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |