C17H11ClN4S — CID 11473228
4-(3-chlorophenyl)-5-(1,5-naphthyridin-2-yl)-1,3-thiazol-2-amine (PubChem CID 11473228) has the molecular formula C17H11ClN4S and a molecular weight of 338.82 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-(1,5-naphthyridin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3-chlorophenyl)-5-(1,5-naphthyridin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 11473228 |
| Molecular Formula | C17H11ClN4S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 4-(3-chlorophenyl)-5-(1,5-naphthyridin-2-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2cccc(Cl)c2)c(-c2ccc3ncccc3n2)s1 |
| InChI | InChI=1S/C17H11ClN4S/c18-11-4-1-3-10(9-11)15-16(23-17(19)22-15)14-7-6-12-13(21-14)5-2-8-20-12/h1-9H,(H2,19,22) |
| InChIKey | JVXFJMXCRSAZFH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |