C16H20O8 — CID 11473262
[(3R,4R,5R,6R)-4,5,6-triacetyloxyoct-1-en-7-yn-3-yl] acetate (PubChem CID 11473262) has the molecular formula C16H20O8 and a molecular weight of 340.33 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-4,5,6-triacetyloxyoct-1-en-7-yn-3-yl] acetate.
| Compound Name | [(3R,4R,5R,6R)-4,5,6-triacetyloxyoct-1-en-7-yn-3-yl] acetate |
|---|---|
| PubChem CID | 11473262 |
| Molecular Formula | C16H20O8 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [(3R,4R,5R,6R)-4,5,6-triacetyloxyoct-1-en-7-yn-3-yl] acetate |
| SMILES | C#C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](C=C)OC(C)=O |
| InChI | InChI=1S/C16H20O8/c1-7-13(21-9(3)17)15(23-11(5)19)16(24-12(6)20)14(8-2)22-10(4)18/h1,8,13-16H,2H2,3-6H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | IBSKEMMILHRFQL-KLHDSHLOSA-N |
| XLogP | 0.53 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|