C17H22ClNO — CID 114732912
2-(7-chloro-1-benzofuran-2-yl)-N-propylcyclohexan-1-amine (PubChem CID 114732912) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is 2-(7-chloro-1-benzofuran-2-yl)-N-propylcyclohexan-1-amine.
| Compound Name | 2-(7-chloro-1-benzofuran-2-yl)-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 114732912 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-(7-chloro-1-benzofuran-2-yl)-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCCCC1c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C17H22ClNO/c1-2-10-19-15-9-4-3-7-13(15)16-11-12-6-5-8-14(18)17(12)20-16/h5-6,8,11,13,15,19H,2-4,7,9-10H2,1H3 |
| InChIKey | JJMLQZZYYZXRBD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |