C16H22O8 — CID 11473324
diethyl (1S,2R,6R,10R,11S)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-8-ene-10,11-dicarboxylate (PubChem CID 11473324) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is diethyl (1S,2R,6R,10R,11S)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-8-ene-10,11-dicarboxylate.
| Compound Name | diethyl (1S,2R,6R,10R,11S)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-8-ene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 11473324 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | diethyl (1S,2R,6R,10R,11S)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-8-ene-10,11-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1O[C@@H]2C(=C[C@H]1C(=O)OCC)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H22O8/c1-5-19-13(17)8-7-9-11(22-10(8)14(18)20-6-2)12-15(21-9)24-16(3,4)23-12/h7-8,10-12,15H,5-6H2,1-4H3/t8-,10+,11-,12-,15-/m1/s1 |
| InChIKey | NZRUZQGKGJZSPG-UGEBGDRKSA-N |
| XLogP | 0.89 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |