About 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran
7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran (PubChem CID 114734014) has the molecular formula C16H16Cl2O
and a molecular weight of 295.21 g/mol. Its IUPAC name is 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran.
Molecular Properties
| Compound Name | 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran |
| PubChem CID | 114734014 |
| Molecular Formula | C16H16Cl2O |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran |
| SMILES | CC1(C)CC(c2cc3cccc(Cl)c3o2)=CC(Cl)C1 |
| InChI | InChI=1S/C16H16Cl2O/c1-16(2)8-11(6-12(17)9-16)14-7-10-4-3-5-13(18)15(10)19-14/h3-7,12H,8-9H2,1-2H3 |
| InChIKey | RXXJPPXTZHOLIV-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran?
The IUPAC name of 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran (CID 114734014) is 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran.
What is the SMILES notation for 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran?
The canonical SMILES for 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran is CC1(C)CC(c2cc3cccc(Cl)c3o2)=CC(Cl)C1.
What is the InChIKey of 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran?
The InChIKey is RXXJPPXTZHOLIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2O/c1-16(2)8-11(6-12(17)9-16)14-7-10-4-3-5-13(18)15(10)19-14/h3-7,12H,8-9H2,1-2H3.
What are the key properties of 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran?
7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran has a molecular weight of 295.21 g/mol, XLogP of 5.90, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-(3-chloro-5,5-dimethylcyclohexen-1-yl)-1-benzofuran is sourced from PubChem (CID 114734014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).