C10H4BrFN2OS — CID 114734262
2-bromo-5-(5-fluoro-1-benzofuran-2-yl)-1,3,4-thiadiazole (PubChem CID 114734262) has the molecular formula C10H4BrFN2OS and a molecular weight of 299.12 g/mol. Its IUPAC name is 2-bromo-5-(5-fluoro-1-benzofuran-2-yl)-1,3,4-thiadiazole.
| Compound Name | 2-bromo-5-(5-fluoro-1-benzofuran-2-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 114734262 |
| Molecular Formula | C10H4BrFN2OS |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | 2-bromo-5-(5-fluoro-1-benzofuran-2-yl)-1,3,4-thiadiazole |
| SMILES | Fc1ccc2oc(-c3nnc(Br)s3)cc2c1 |
| InChI | InChI=1S/C10H4BrFN2OS/c11-10-14-13-9(16-10)8-4-5-3-6(12)1-2-7(5)15-8/h1-4H |
| InChIKey | KNMYYXBTDRUUJS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |