C17H34O5Si — CID 11473473
(2R)-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]-2-(2-trimethylsilylethoxymethoxy)ethanol (PubChem CID 11473473) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is (2R)-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]-2-(2-trimethylsilylethoxymethoxy)ethanol.
| Compound Name | (2R)-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]-2-(2-trimethylsilylethoxymethoxy)ethanol |
|---|---|
| PubChem CID | 11473473 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (2R)-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]-2-(2-trimethylsilylethoxymethoxy)ethanol |
| SMILES | C=C1C[C@](OC)([C@@H](CO)OCOCC[Si](C)(C)C)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C17H34O5Si/c1-13-10-17(19-4,22-15(3)14(13)2)16(11-18)21-12-20-8-9-23(5,6)7/h14-16,18H,1,8-12H2,2-7H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | TUVHJKCUZFCLCX-QBPKDAKJSA-N |
| XLogP | 3.02 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|