C17H21N3O3S — CID 11473488
4-(3,3-dimethylbutanoylamino)-2-methoxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 11473488) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 4-(3,3-dimethylbutanoylamino)-2-methoxy-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-(3,3-dimethylbutanoylamino)-2-methoxy-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 11473488 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-(3,3-dimethylbutanoylamino)-2-methoxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COc1cc(NC(=O)CC(C)(C)C)ccc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C17H21N3O3S/c1-17(2,3)10-14(21)19-11-5-6-12(13(9-11)23-4)15(22)20-16-18-7-8-24-16/h5-9H,10H2,1-4H3,(H,19,21)(H,18,20,22) |
| InChIKey | QKTXEHDRNNYFGM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |