C14H12FN3O — CID 114734954
2-ethyl-6-(7-fluoro-1-benzofuran-2-yl)pyrimidin-4-amine (PubChem CID 114734954) has the molecular formula C14H12FN3O and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-ethyl-6-(7-fluoro-1-benzofuran-2-yl)pyrimidin-4-amine.
| Compound Name | 2-ethyl-6-(7-fluoro-1-benzofuran-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114734954 |
| Molecular Formula | C14H12FN3O |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-ethyl-6-(7-fluoro-1-benzofuran-2-yl)pyrimidin-4-amine |
| SMILES | CCc1nc(N)cc(-c2cc3cccc(F)c3o2)n1 |
| InChI | InChI=1S/C14H12FN3O/c1-2-13-17-10(7-12(16)18-13)11-6-8-4-3-5-9(15)14(8)19-11/h3-7H,2H2,1H3,(H2,16,17,18) |
| InChIKey | BJCFBCBYHQRTML-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |