C19H17F3O3 — CID 11473557
(2S,3aR,4S,9bS)-4-(4-hydroxyphenyl)-2-(trifluoromethyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol (PubChem CID 11473557) has the molecular formula C19H17F3O3 and a molecular weight of 350.34 g/mol. Its IUPAC name is (2S,3aR,4S,9bS)-4-(4-hydroxyphenyl)-2-(trifluoromethyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol.
| Compound Name | (2S,3aR,4S,9bS)-4-(4-hydroxyphenyl)-2-(trifluoromethyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol |
|---|---|
| PubChem CID | 11473557 |
| Molecular Formula | C19H17F3O3 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (2S,3aR,4S,9bS)-4-(4-hydroxyphenyl)-2-(trifluoromethyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol |
| SMILES | Oc1ccc([C@H]2Oc3ccc(O)cc3[C@H]3C[C@H](C(F)(F)F)C[C@H]32)cc1 |
| InChI | InChI=1S/C19H17F3O3/c20-19(21,22)11-7-14-15-9-13(24)5-6-17(15)25-18(16(14)8-11)10-1-3-12(23)4-2-10/h1-6,9,11,14,16,18,23-24H,7-8H2/t11-,14+,16+,18+/m0/s1 |
| InChIKey | CLYUNXJFERDYMU-KHXXDLOKSA-N |
| XLogP | 4.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |