C14H17NO4S — CID 114736219
2-amino-1-(7-methyl-1-benzofuran-2-yl)-4-methylsulfonylbutan-1-one (PubChem CID 114736219) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-amino-1-(7-methyl-1-benzofuran-2-yl)-4-methylsulfonylbutan-1-one.
| Compound Name | 2-amino-1-(7-methyl-1-benzofuran-2-yl)-4-methylsulfonylbutan-1-one |
|---|---|
| PubChem CID | 114736219 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-amino-1-(7-methyl-1-benzofuran-2-yl)-4-methylsulfonylbutan-1-one |
| SMILES | Cc1cccc2cc(C(=O)C(N)CCS(C)(=O)=O)oc12 |
| InChI | InChI=1S/C14H17NO4S/c1-9-4-3-5-10-8-12(19-14(9)10)13(16)11(15)6-7-20(2,17)18/h3-5,8,11H,6-7,15H2,1-2H3 |
| InChIKey | DGKDTBSYZAFNMI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |