C12H12ClNO2 — CID 114736248
4-amino-1-(7-chloro-1-benzofuran-2-yl)butan-1-one (PubChem CID 114736248) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is 4-amino-1-(7-chloro-1-benzofuran-2-yl)butan-1-one.
| Compound Name | 4-amino-1-(7-chloro-1-benzofuran-2-yl)butan-1-one |
|---|---|
| PubChem CID | 114736248 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4-amino-1-(7-chloro-1-benzofuran-2-yl)butan-1-one |
| SMILES | NCCCC(=O)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C12H12ClNO2/c13-9-4-1-3-8-7-11(16-12(8)9)10(15)5-2-6-14/h1,3-4,7H,2,5-6,14H2 |
| InChIKey | GPIVPGKBWUNWOV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |