C18H24O5S — CID 11473625
2-(carboxymethylsulfanyl)-4-oxo-4-(2,4,6-triethylphenyl)butanoic acid (PubChem CID 11473625) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is 2-(carboxymethylsulfanyl)-4-oxo-4-(2,4,6-triethylphenyl)butanoic acid.
| Compound Name | 2-(carboxymethylsulfanyl)-4-oxo-4-(2,4,6-triethylphenyl)butanoic acid |
|---|---|
| PubChem CID | 11473625 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-(carboxymethylsulfanyl)-4-oxo-4-(2,4,6-triethylphenyl)butanoic acid |
| SMILES | CCc1cc(CC)c(C(=O)CC(SCC(=O)O)C(=O)O)c(CC)c1 |
| InChI | InChI=1S/C18H24O5S/c1-4-11-7-12(5-2)17(13(6-3)8-11)14(19)9-15(18(22)23)24-10-16(20)21/h7-8,15H,4-6,9-10H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | VPWVHPRCVVRQET-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |