C22H40O3 — CID 11473635
(4R)-2,2-dimethyl-4-[(4S)-4-(2-methylprop-2-enoxy)tridec-1-en-4-yl]-1,3-dioxolane (PubChem CID 11473635) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-4-[(4S)-4-(2-methylprop-2-enoxy)tridec-1-en-4-yl]-1,3-dioxolane.
| Compound Name | (4R)-2,2-dimethyl-4-[(4S)-4-(2-methylprop-2-enoxy)tridec-1-en-4-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11473635 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | (4R)-2,2-dimethyl-4-[(4S)-4-(2-methylprop-2-enoxy)tridec-1-en-4-yl]-1,3-dioxolane |
| SMILES | C=CC[C@](CCCCCCCCC)(OCC(=C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H40O3/c1-7-9-10-11-12-13-14-16-22(15-8-2,24-17-19(3)4)20-18-23-21(5,6)25-20/h8,20H,2-3,7,9-18H2,1,4-6H3/t20-,22-/m1/s1 |
| InChIKey | XAAMUHSHGQWZTN-IFMALSPDSA-N |
| XLogP | 6.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|