C12H14N6O2 — CID 114738039
ethyl 2-(1H-1,2,4-triazol-5-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-4-carboxylate (PubChem CID 114738039) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is ethyl 2-(1H-1,2,4-triazol-5-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-4-carboxylate.
| Compound Name | ethyl 2-(1H-1,2,4-triazol-5-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 114738039 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | ethyl 2-(1H-1,2,4-triazol-5-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ncn[nH]2)nc2c1CNCC2 |
| InChI | InChI=1S/C12H14N6O2/c1-2-20-12(19)9-7-5-13-4-3-8(7)16-11(17-9)10-14-6-15-18-10/h6,13H,2-5H2,1H3,(H,14,15,18) |
| InChIKey | YAFFUMBNVJRYPU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |