C18H20N2O4S — CID 11473879
N-hydroxy-2-[[4-(2-methylphenyl)phenyl]methyl]-1,1-dioxo-1,2-thiazolidine-3-carboxamide (PubChem CID 11473879) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-hydroxy-2-[[4-(2-methylphenyl)phenyl]methyl]-1,1-dioxo-1,2-thiazolidine-3-carboxamide.
| Compound Name | N-hydroxy-2-[[4-(2-methylphenyl)phenyl]methyl]-1,1-dioxo-1,2-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 11473879 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-hydroxy-2-[[4-(2-methylphenyl)phenyl]methyl]-1,1-dioxo-1,2-thiazolidine-3-carboxamide |
| SMILES | Cc1ccccc1-c1ccc(CN2C(C(=O)NO)CCS2(=O)=O)cc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-13-4-2-3-5-16(13)15-8-6-14(7-9-15)12-20-17(18(21)19-22)10-11-25(20,23)24/h2-9,17,22H,10-12H2,1H3,(H,19,21) |
| InChIKey | QDICWLMZEKDVEQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|