C18H36O5Si — CID 11473896
(4aR,6S,7R,8aS)-2,2-ditert-butyl-6-(2-hydroxyethyl)-4a,6-dimethyl-4,7,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol (PubChem CID 11473896) has the molecular formula C18H36O5Si and a molecular weight of 360.57 g/mol. Its IUPAC name is (4aR,6S,7R,8aS)-2,2-ditert-butyl-6-(2-hydroxyethyl)-4a,6-dimethyl-4,7,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol.
| Compound Name | (4aR,6S,7R,8aS)-2,2-ditert-butyl-6-(2-hydroxyethyl)-4a,6-dimethyl-4,7,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol |
|---|---|
| PubChem CID | 11473896 |
| Molecular Formula | C18H36O5Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (4aR,6S,7R,8aS)-2,2-ditert-butyl-6-(2-hydroxyethyl)-4a,6-dimethyl-4,7,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@@]2(C)O[C@@](C)(CCO)[C@H](O)C[C@@H]2O1 |
| InChI | InChI=1S/C18H36O5Si/c1-15(2,3)24(16(4,5)6)21-12-18(8)14(22-24)11-13(20)17(7,23-18)9-10-19/h13-14,19-20H,9-12H2,1-8H3/t13-,14+,17+,18-/m1/s1 |
| InChIKey | BCMFWMVAZRXVLY-IDCJVQTKSA-N |
| XLogP | 3.13 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|