C15H7Cl2N3O2S — CID 11473961
5-(2,4-dichlorophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione (PubChem CID 11473961) has the molecular formula C15H7Cl2N3O2S and a molecular weight of 364.21 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione.
| Compound Name | 5-(2,4-dichlorophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione |
|---|---|
| PubChem CID | 11473961 |
| Molecular Formula | C15H7Cl2N3O2S |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione |
| SMILES | O=c1[nH]c2c(sc3ncccc32)c(=O)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H7Cl2N3O2S/c16-7-3-4-10(9(17)6-7)20-14(21)12-11(19-15(20)22)8-2-1-5-18-13(8)23-12/h1-6H,(H,19,22) |
| InChIKey | XLKMQBXSLZLNEU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |