C14H15N3 — CID 114740532
2-(4-ethylphenyl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (PubChem CID 114740532) has the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
| Compound Name | 2-(4-ethylphenyl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 114740532 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-(4-ethylphenyl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| SMILES | CCc1ccc(-c2ncc3c(n2)CNC3)cc1 |
| InChI | InChI=1S/C14H15N3/c1-2-10-3-5-11(6-4-10)14-16-8-12-7-15-9-13(12)17-14/h3-6,8,15H,2,7,9H2,1H3 |
| InChIKey | YFRZBPWNFSGRBQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |