About 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine
2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (PubChem CID 114741234) has the molecular formula C16H27N3O
and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| PubChem CID | 114741234 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| SMILES | CCOC(CC)(CC)c1nc2c(c(C(C)C)n1)CNC2 |
| InChI | InChI=1S/C16H27N3O/c1-6-16(7-2,20-8-3)15-18-13-10-17-9-12(13)14(19-15)11(4)5/h11,17H,6-10H2,1-5H3 |
| InChIKey | KUNFFDAMQUGDEO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The IUPAC name of 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (CID 114741234) is 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
What is the SMILES notation for 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The canonical SMILES for 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is CCOC(CC)(CC)c1nc2c(c(C(C)C)n1)CNC2.
What is the InChIKey of 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The InChIKey is KUNFFDAMQUGDEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O/c1-6-16(7-2,20-8-3)15-18-13-10-17-9-12(13)14(19-15)11(4)5/h11,17H,6-10H2,1-5H3.
What are the key properties of 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine has a molecular weight of 277.41 g/mol, XLogP of 3.26, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethoxypentan-3-yl)-4-propan-2-yl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is sourced from PubChem (CID 114741234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).