C23H29FN2O — CID 11474124
(1R)-1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-2,2-dimethylpropan-1-ol (PubChem CID 11474124) has the molecular formula C23H29FN2O and a molecular weight of 368.50 g/mol. Its IUPAC name is (1R)-1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | (1R)-1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 11474124 |
| Molecular Formula | C23H29FN2O |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | (1R)-1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)[C@H](O)[C@H]1CCCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C |
| InChI | InChI=1S/C23H29FN2O/c1-22(2,3)21(27)19-7-5-6-16-12-20-15(13-23(16,19)4)14-25-26(20)18-10-8-17(24)9-11-18/h8-12,14,19,21,27H,5-7,13H2,1-4H3/t19-,21-,23+/m1/s1 |
| InChIKey | XAMZHALVIXXTIZ-LSWJPFSZSA-N |
| XLogP | 5.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |