C20H23FN4O2 — CID 11474174
(2E)-N-(2-aminocyclohexyl)-2-(7-fluoro-1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)acetamide (PubChem CID 11474174) has the molecular formula C20H23FN4O2 and a molecular weight of 370.43 g/mol. Its IUPAC name is (2E)-N-(2-aminocyclohexyl)-2-(7-fluoro-1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)acetamide.
| Compound Name | (2E)-N-(2-aminocyclohexyl)-2-(7-fluoro-1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)acetamide |
|---|---|
| PubChem CID | 11474174 |
| Molecular Formula | C20H23FN4O2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (2E)-N-(2-aminocyclohexyl)-2-(7-fluoro-1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)acetamide |
| SMILES | NC1CCCCC1NC(=O)/C=C1\CCNC(=O)c2[nH]c3ccc(F)cc3c21 |
| InChI | InChI=1S/C20H23FN4O2/c21-12-5-6-15-13(10-12)18-11(7-8-23-20(27)19(18)25-15)9-17(26)24-16-4-2-1-3-14(16)22/h5-6,9-10,14,16,25H,1-4,7-8,22H2,(H,23,27)(H,24,26)/b11-9+ |
| InChIKey | CXSUBBZNBKCMRG-PKNBQFBNSA-N |
| XLogP | 2.21 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|